C26H28Cl3N3O5S — CID 126511103
4-methoxy-N-[2-(5-methoxynaphthalen-1-yl)ethyl]-3-[4-(2,2,2-trichloroacetyl)piperazin-1-yl]benzenesulfonamide (PubChem CID 126511103) has the molecular formula C26H28Cl3N3O5S and a molecular weight of 600.95 g/mol. Its IUPAC name is 4-methoxy-N-[2-(5-methoxynaphthalen-1-yl)ethyl]-3-[4-(2,2,2-trichloroacetyl)piperazin-1-yl]benzenesulfonamide.
| Compound Name | 4-methoxy-N-[2-(5-methoxynaphthalen-1-yl)ethyl]-3-[4-(2,2,2-trichloroacetyl)piperazin-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 126511103 |
| Molecular Formula | C26H28Cl3N3O5S |
| Molecular Weight | 600.95 g/mol |
| Exact Mass | 599.08 |
| IUPAC Name | 4-methoxy-N-[2-(5-methoxynaphthalen-1-yl)ethyl]-3-[4-(2,2,2-trichloroacetyl)piperazin-1-yl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCCc2cccc3c(OC)cccc23)cc1N1CCN(C(=O)C(Cl)(Cl)Cl)CC1 |
| InChI | InChI=1S/C26H28Cl3N3O5S/c1-36-23-8-4-6-20-18(5-3-7-21(20)23)11-12-30-38(34,35)19-9-10-24(37-2)22(17-19)31-13-15-32(16-14-31)25(33)26(27,28)29/h3-10,17,30H,11-16H2,1-2H3 |
| InChIKey | KFECUWHYTXMCCF-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.95 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|