C22H21Cl3FN3O4S — CID 175359434
2,2,2-trichloro-1-[4-[5-[(5-fluoro-3-methyl-1H-indol-2-yl)sulfonyl]-2-methoxyphenyl]piperazin-1-yl]ethanone (PubChem CID 175359434) has the molecular formula C22H21Cl3FN3O4S and a molecular weight of 548.85 g/mol. Its IUPAC name is 2,2,2-trichloro-1-[4-[5-[(5-fluoro-3-methyl-1H-indol-2-yl)sulfonyl]-2-methoxyphenyl]piperazin-1-yl]ethanone.
| Compound Name | 2,2,2-trichloro-1-[4-[5-[(5-fluoro-3-methyl-1H-indol-2-yl)sulfonyl]-2-methoxyphenyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 175359434 |
| Molecular Formula | C22H21Cl3FN3O4S |
| Molecular Weight | 548.85 g/mol |
| Exact Mass | 547.03 |
| IUPAC Name | 2,2,2-trichloro-1-[4-[5-[(5-fluoro-3-methyl-1H-indol-2-yl)sulfonyl]-2-methoxyphenyl]piperazin-1-yl]ethanone |
| SMILES | COc1ccc(S(=O)(=O)c2[nH]c3ccc(F)cc3c2C)cc1N1CCN(C(=O)C(Cl)(Cl)Cl)CC1 |
| InChI | InChI=1S/C22H21Cl3FN3O4S/c1-13-16-11-14(26)3-5-17(16)27-20(13)34(31,32)15-4-6-19(33-2)18(12-15)28-7-9-29(10-8-28)21(30)22(23,24)25/h3-6,11-12,27H,7-10H2,1-2H3 |
| InChIKey | NLPUGXLUWACDNJ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 82.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.85 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|