C22H26F3N3O2S — CID 144864074
3-(difluoromethyl)-5-fluoro-1-(4-methoxy-3-piperazin-1-ylphenyl)sulfinylindole;ethane (PubChem CID 144864074) has the molecular formula C22H26F3N3O2S and a molecular weight of 453.53 g/mol. Its IUPAC name is 3-(difluoromethyl)-5-fluoro-1-(4-methoxy-3-piperazin-1-ylphenyl)sulfinylindole;ethane.
| Compound Name | 3-(difluoromethyl)-5-fluoro-1-(4-methoxy-3-piperazin-1-ylphenyl)sulfinylindole;ethane |
|---|---|
| PubChem CID | 144864074 |
| Molecular Formula | C22H26F3N3O2S |
| Molecular Weight | 453.53 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | 3-(difluoromethyl)-5-fluoro-1-(4-methoxy-3-piperazin-1-ylphenyl)sulfinylindole;ethane |
| SMILES | CC.COc1ccc(S(=O)n2cc(C(F)F)c3cc(F)ccc32)cc1N1CCNCC1 |
| InChI | InChI=1S/C20H20F3N3O2S.C2H6/c1-28-19-5-3-14(11-18(19)25-8-6-24-7-9-25)29(27)26-12-16(20(22)23)15-10-13(21)2-4-17(15)26;1-2/h2-5,10-12,20,24H,6-9H2,1H3;1-2H3 |
| InChIKey | XZJMBRMMDDDXKY-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.53 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |