C21H22N4O2S — CID 155371435
1-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]sulfinylindole-5-carbonitrile (PubChem CID 155371435) has the molecular formula C21H22N4O2S and a molecular weight of 394.50 g/mol. Its IUPAC name is 1-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]sulfinylindole-5-carbonitrile.
| Compound Name | 1-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]sulfinylindole-5-carbonitrile |
|---|---|
| PubChem CID | 155371435 |
| Molecular Formula | C21H22N4O2S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 1-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]sulfinylindole-5-carbonitrile |
| SMILES | COc1ccc(S(=O)n2ccc3cc(C#N)ccc32)cc1N1CCN(C)CC1 |
| InChI | InChI=1S/C21H22N4O2S/c1-23-9-11-24(12-10-23)20-14-18(4-6-21(20)27-2)28(26)25-8-7-17-13-16(15-22)3-5-19(17)25/h3-8,13-14H,9-12H2,1-2H3 |
| InChIKey | FHIRVCJHYKXQCX-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 61.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |