C24H22BrF2N3O2S — CID 144864092
5-bromo-3-(difluoromethyl)-1-(4-methoxy-3-piperazin-1-ylnaphthalen-1-yl)sulfinylindole (PubChem CID 144864092) has the molecular formula C24H22BrF2N3O2S and a molecular weight of 534.43 g/mol. Its IUPAC name is 5-bromo-3-(difluoromethyl)-1-(4-methoxy-3-piperazin-1-ylnaphthalen-1-yl)sulfinylindole.
| Compound Name | 5-bromo-3-(difluoromethyl)-1-(4-methoxy-3-piperazin-1-ylnaphthalen-1-yl)sulfinylindole |
|---|---|
| PubChem CID | 144864092 |
| Molecular Formula | C24H22BrF2N3O2S |
| Molecular Weight | 534.43 g/mol |
| Exact Mass | 533.06 |
| IUPAC Name | 5-bromo-3-(difluoromethyl)-1-(4-methoxy-3-piperazin-1-ylnaphthalen-1-yl)sulfinylindole |
| SMILES | COc1c(N2CCNCC2)cc(S(=O)n2cc(C(F)F)c3cc(Br)ccc32)c2ccccc12 |
| InChI | InChI=1S/C24H22BrF2N3O2S/c1-32-23-17-5-3-2-4-16(17)22(13-21(23)29-10-8-28-9-11-29)33(31)30-14-19(24(26)27)18-12-15(25)6-7-20(18)30/h2-7,12-14,24,28H,8-11H2,1H3 |
| InChIKey | POFOKAJCBAJIAX-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.43 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |