C19H18F3N3OS — CID 144993583
3-(difluoromethyl)-1-(3-fluorophenyl)sulfinyl-4-piperazin-1-ylindole (PubChem CID 144993583) has the molecular formula C19H18F3N3OS and a molecular weight of 393.43 g/mol. Its IUPAC name is 3-(difluoromethyl)-1-(3-fluorophenyl)sulfinyl-4-piperazin-1-ylindole.
| Compound Name | 3-(difluoromethyl)-1-(3-fluorophenyl)sulfinyl-4-piperazin-1-ylindole |
|---|---|
| PubChem CID | 144993583 |
| Molecular Formula | C19H18F3N3OS |
| Molecular Weight | 393.43 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | 3-(difluoromethyl)-1-(3-fluorophenyl)sulfinyl-4-piperazin-1-ylindole |
| SMILES | O=S(c1cccc(F)c1)n1cc(C(F)F)c2c(N3CCNCC3)cccc21 |
| InChI | InChI=1S/C19H18F3N3OS/c20-13-3-1-4-14(11-13)27(26)25-12-15(19(21)22)18-16(5-2-6-17(18)25)24-9-7-23-8-10-24/h1-6,11-12,19,23H,7-10H2 |
| InChIKey | ICLWJSQJEMQHTB-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.43 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |