C21H23F2N3O2S — CID 126754890
3-(difluoromethyl)-1-(3-methylphenyl)sulfonyl-4-(4-methylpiperazin-1-yl)indole (PubChem CID 126754890) has the molecular formula C21H23F2N3O2S and a molecular weight of 419.50 g/mol. Its IUPAC name is 3-(difluoromethyl)-1-(3-methylphenyl)sulfonyl-4-(4-methylpiperazin-1-yl)indole.
| Compound Name | 3-(difluoromethyl)-1-(3-methylphenyl)sulfonyl-4-(4-methylpiperazin-1-yl)indole |
|---|---|
| PubChem CID | 126754890 |
| Molecular Formula | C21H23F2N3O2S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 3-(difluoromethyl)-1-(3-methylphenyl)sulfonyl-4-(4-methylpiperazin-1-yl)indole |
| SMILES | Cc1cccc(S(=O)(=O)n2cc(C(F)F)c3c(N4CCN(C)CC4)cccc32)c1 |
| InChI | InChI=1S/C21H23F2N3O2S/c1-15-5-3-6-16(13-15)29(27,28)26-14-17(21(22)23)20-18(7-4-8-19(20)26)25-11-9-24(2)10-12-25/h3-8,13-14,21H,9-12H2,1-2H3 |
| InChIKey | DFXWDPGTYHYNOD-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |