C21H17BrCl3F2N3O3S — CID 126740581
1-[4-[1-(2-bromophenyl)sulfonyl-3-(difluoromethyl)indol-4-yl]piperazin-1-yl]-2,2,2-trichloroethanone (PubChem CID 126740581) has the molecular formula C21H17BrCl3F2N3O3S and a molecular weight of 615.71 g/mol. Its IUPAC name is 1-[4-[1-(2-bromophenyl)sulfonyl-3-(difluoromethyl)indol-4-yl]piperazin-1-yl]-2,2,2-trichloroethanone.
| Compound Name | 1-[4-[1-(2-bromophenyl)sulfonyl-3-(difluoromethyl)indol-4-yl]piperazin-1-yl]-2,2,2-trichloroethanone |
|---|---|
| PubChem CID | 126740581 |
| Molecular Formula | C21H17BrCl3F2N3O3S |
| Molecular Weight | 615.71 g/mol |
| Exact Mass | 612.92 |
| IUPAC Name | 1-[4-[1-(2-bromophenyl)sulfonyl-3-(difluoromethyl)indol-4-yl]piperazin-1-yl]-2,2,2-trichloroethanone |
| SMILES | O=C(N1CCN(c2cccc3c2c(C(F)F)cn3S(=O)(=O)c2ccccc2Br)CC1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C21H17BrCl3F2N3O3S/c22-14-4-1-2-7-17(14)34(32,33)30-12-13(19(26)27)18-15(5-3-6-16(18)30)28-8-10-29(11-9-28)20(31)21(23,24)25/h1-7,12,19H,8-11H2 |
| InChIKey | PWXPREDMAFWRDA-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.71 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|