C19H17BrF3N3O2S — CID 118654349
1-(2-bromophenyl)sulfonyl-4-piperazin-1-yl-3-(trifluoromethyl)indole (PubChem CID 118654349) has the molecular formula C19H17BrF3N3O2S and a molecular weight of 488.33 g/mol. Its IUPAC name is 1-(2-bromophenyl)sulfonyl-4-piperazin-1-yl-3-(trifluoromethyl)indole.
| Compound Name | 1-(2-bromophenyl)sulfonyl-4-piperazin-1-yl-3-(trifluoromethyl)indole |
|---|---|
| PubChem CID | 118654349 |
| Molecular Formula | C19H17BrF3N3O2S |
| Molecular Weight | 488.33 g/mol |
| Exact Mass | 487.02 |
| IUPAC Name | 1-(2-bromophenyl)sulfonyl-4-piperazin-1-yl-3-(trifluoromethyl)indole |
| SMILES | O=S(=O)(c1ccccc1Br)n1cc(C(F)(F)F)c2c(N3CCNCC3)cccc21 |
| InChI | InChI=1S/C19H17BrF3N3O2S/c20-14-4-1-2-7-17(14)29(27,28)26-12-13(19(21,22)23)18-15(5-3-6-16(18)26)25-10-8-24-9-11-25/h1-7,12,24H,8-11H2 |
| InChIKey | NGPCEWMPONBFCL-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.33 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |