C21H17Cl4N3O4S — CID 118648029
1-(3-chlorophenyl)sulfonyl-4-[4-(2,2,2-trichloroacetyl)piperazin-1-yl]indole-3-carbaldehyde (PubChem CID 118648029) has the molecular formula C21H17Cl4N3O4S and a molecular weight of 549.26 g/mol. Its IUPAC name is 1-(3-chlorophenyl)sulfonyl-4-[4-(2,2,2-trichloroacetyl)piperazin-1-yl]indole-3-carbaldehyde.
| Compound Name | 1-(3-chlorophenyl)sulfonyl-4-[4-(2,2,2-trichloroacetyl)piperazin-1-yl]indole-3-carbaldehyde |
|---|---|
| PubChem CID | 118648029 |
| Molecular Formula | C21H17Cl4N3O4S |
| Molecular Weight | 549.26 g/mol |
| Exact Mass | 546.97 |
| IUPAC Name | 1-(3-chlorophenyl)sulfonyl-4-[4-(2,2,2-trichloroacetyl)piperazin-1-yl]indole-3-carbaldehyde |
| SMILES | O=Cc1cn(S(=O)(=O)c2cccc(Cl)c2)c2cccc(N3CCN(C(=O)C(Cl)(Cl)Cl)CC3)c12 |
| InChI | InChI=1S/C21H17Cl4N3O4S/c22-15-3-1-4-16(11-15)33(31,32)28-12-14(13-29)19-17(5-2-6-18(19)28)26-7-9-27(10-8-26)20(30)21(23,24)25/h1-6,11-13H,7-10H2 |
| InChIKey | OXMPYKVMFUXLFU-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 79.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.26 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|