C24H27BrN2O3S — CID 160831634
1-(3-bromophenyl)sulfonyl-4-(1-tert-butylpiperidin-4-yl)indole-3-carbaldehyde (PubChem CID 160831634) has the molecular formula C24H27BrN2O3S and a molecular weight of 503.46 g/mol. Its IUPAC name is 1-(3-bromophenyl)sulfonyl-4-(1-tert-butylpiperidin-4-yl)indole-3-carbaldehyde.
| Compound Name | 1-(3-bromophenyl)sulfonyl-4-(1-tert-butylpiperidin-4-yl)indole-3-carbaldehyde |
|---|---|
| PubChem CID | 160831634 |
| Molecular Formula | C24H27BrN2O3S |
| Molecular Weight | 503.46 g/mol |
| Exact Mass | 502.09 |
| IUPAC Name | 1-(3-bromophenyl)sulfonyl-4-(1-tert-butylpiperidin-4-yl)indole-3-carbaldehyde |
| SMILES | CC(C)(C)N1CCC(c2cccc3c2c(C=O)cn3S(=O)(=O)c2cccc(Br)c2)CC1 |
| InChI | InChI=1S/C24H27BrN2O3S/c1-24(2,3)26-12-10-17(11-13-26)21-8-5-9-22-23(21)18(16-28)15-27(22)31(29,30)20-7-4-6-19(25)14-20/h4-9,14-17H,10-13H2,1-3H3 |
| InChIKey | SGWHHMWKESDAJH-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.46 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|