C19H17ClF3N3O2S — CID 150729010
1-[2-chloro-5-(trifluoromethyl)phenyl]sulfonyl-4-piperidin-1-ylbenzimidazole (PubChem CID 150729010) has the molecular formula C19H17ClF3N3O2S and a molecular weight of 443.88 g/mol. Its IUPAC name is 1-[2-chloro-5-(trifluoromethyl)phenyl]sulfonyl-4-piperidin-1-ylbenzimidazole.
| Compound Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]sulfonyl-4-piperidin-1-ylbenzimidazole |
|---|---|
| PubChem CID | 150729010 |
| Molecular Formula | C19H17ClF3N3O2S |
| Molecular Weight | 443.88 g/mol |
| Exact Mass | 443.07 |
| IUPAC Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]sulfonyl-4-piperidin-1-ylbenzimidazole |
| SMILES | O=S(=O)(c1cc(C(F)(F)F)ccc1Cl)n1cnc2c(N3CCCCC3)cccc21 |
| InChI | InChI=1S/C19H17ClF3N3O2S/c20-14-8-7-13(19(21,22)23)11-17(14)29(27,28)26-12-24-18-15(5-4-6-16(18)26)25-9-2-1-3-10-25/h4-8,11-12H,1-3,9-10H2 |
| InChIKey | JRLDOKDNDXWDQI-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.88 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |