C19H22N2O7S — CID 4741945
5-[4-(2,5-dimethoxyphenyl)sulfonylpiperazin-1-yl]-2-hydroxybenzoic acid (PubChem CID 4741945) has the molecular formula C19H22N2O7S and a molecular weight of 422.46 g/mol. Its IUPAC name is 5-[4-(2,5-dimethoxyphenyl)sulfonylpiperazin-1-yl]-2-hydroxybenzoic acid.
| Compound Name | 5-[4-(2,5-dimethoxyphenyl)sulfonylpiperazin-1-yl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 4741945 |
| Molecular Formula | C19H22N2O7S |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | 5-[4-(2,5-dimethoxyphenyl)sulfonylpiperazin-1-yl]-2-hydroxybenzoic acid |
| SMILES | COc1ccc(OC)c(S(=O)(=O)N2CCN(c3ccc(O)c(C(=O)O)c3)CC2)c1 |
| InChI | InChI=1S/C19H22N2O7S/c1-27-14-4-6-17(28-2)18(12-14)29(25,26)21-9-7-20(8-10-21)13-3-5-16(22)15(11-13)19(23)24/h3-6,11-12,22H,7-10H2,1-2H3,(H,23,24) |
| InChIKey | BQOZFVFJIIQTNS-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 116.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |