C25H35N7O4 — CID 161439128
tert-butyl formate;4-[2-methoxy-6-(6-piperazin-1-ylindazol-1-yl)pyrimidin-4-yl]morpholine (PubChem CID 161439128) has the molecular formula C25H35N7O4 and a molecular weight of 497.60 g/mol. Its IUPAC name is tert-butyl formate;4-[2-methoxy-6-(6-piperazin-1-ylindazol-1-yl)pyrimidin-4-yl]morpholine.
| Compound Name | tert-butyl formate;4-[2-methoxy-6-(6-piperazin-1-ylindazol-1-yl)pyrimidin-4-yl]morpholine |
|---|---|
| PubChem CID | 161439128 |
| Molecular Formula | C25H35N7O4 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.28 |
| IUPAC Name | tert-butyl formate;4-[2-methoxy-6-(6-piperazin-1-ylindazol-1-yl)pyrimidin-4-yl]morpholine |
| SMILES | CC(C)(C)OC=O.COc1nc(N2CCOCC2)cc(-n2ncc3ccc(N4CCNCC4)cc32)n1 |
| InChI | InChI=1S/C20H25N7O2.C5H10O2/c1-28-20-23-18(26-8-10-29-11-9-26)13-19(24-20)27-17-12-16(3-2-15(17)14-22-27)25-6-4-21-5-7-25;1-5(2,3)7-4-6/h2-3,12-14,21H,4-11H2,1H3;4H,1-3H3 |
| InChIKey | VZAPSKRIHLTKBG-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|