C22H28N6O3 — CID 145234277
4-[1-(2-methoxy-6-morpholin-4-ylpyrimidin-4-yl)-5-methylindazol-6-yl]piperidin-3-ol (PubChem CID 145234277) has the molecular formula C22H28N6O3 and a molecular weight of 424.51 g/mol. Its IUPAC name is 4-[1-(2-methoxy-6-morpholin-4-ylpyrimidin-4-yl)-5-methylindazol-6-yl]piperidin-3-ol.
| Compound Name | 4-[1-(2-methoxy-6-morpholin-4-ylpyrimidin-4-yl)-5-methylindazol-6-yl]piperidin-3-ol |
|---|---|
| PubChem CID | 145234277 |
| Molecular Formula | C22H28N6O3 |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | 4-[1-(2-methoxy-6-morpholin-4-ylpyrimidin-4-yl)-5-methylindazol-6-yl]piperidin-3-ol |
| SMILES | COc1nc(N2CCOCC2)cc(-n2ncc3cc(C)c(C4CCNCC4O)cc32)n1 |
| InChI | InChI=1S/C22H28N6O3/c1-14-9-15-12-24-28(18(15)10-17(14)16-3-4-23-13-19(16)29)21-11-20(25-22(26-21)30-2)27-5-7-31-8-6-27/h9-12,16,19,23,29H,3-8,13H2,1-2H3 |
| InChIKey | HZLMEBIZGDRBKS-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 97.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |