C18H20N4O5S — CID 143738633
formic acid;2-(6-piperazin-1-ylindazol-1-yl)sulfonylphenol (PubChem CID 143738633) has the molecular formula C18H20N4O5S and a molecular weight of 404.45 g/mol. Its IUPAC name is formic acid;2-(6-piperazin-1-ylindazol-1-yl)sulfonylphenol.
| Compound Name | formic acid;2-(6-piperazin-1-ylindazol-1-yl)sulfonylphenol |
|---|---|
| PubChem CID | 143738633 |
| Molecular Formula | C18H20N4O5S |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | formic acid;2-(6-piperazin-1-ylindazol-1-yl)sulfonylphenol |
| SMILES | O=CO.O=S(=O)(c1ccccc1O)n1ncc2ccc(N3CCNCC3)cc21 |
| InChI | InChI=1S/C17H18N4O3S.CH2O2/c22-16-3-1-2-4-17(16)25(23,24)21-15-11-14(6-5-13(15)12-19-21)20-9-7-18-8-10-20;2-1-3/h1-6,11-12,18,22H,7-10H2;1H,(H,2,3) |
| InChIKey | JFQYHLQLGVAGTA-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|