C24H25Cl2N3O2S — CID 139997494
1-(4-phenylphenyl)sulfonyl-5-piperazin-1-ylindole;dihydrochloride (PubChem CID 139997494) has the molecular formula C24H25Cl2N3O2S and a molecular weight of 490.46 g/mol. Its IUPAC name is 1-(4-phenylphenyl)sulfonyl-5-piperazin-1-ylindole;dihydrochloride.
| Compound Name | 1-(4-phenylphenyl)sulfonyl-5-piperazin-1-ylindole;dihydrochloride |
|---|---|
| PubChem CID | 139997494 |
| Molecular Formula | C24H25Cl2N3O2S |
| Molecular Weight | 490.46 g/mol |
| Exact Mass | 489.10 |
| IUPAC Name | 1-(4-phenylphenyl)sulfonyl-5-piperazin-1-ylindole;dihydrochloride |
| SMILES | Cl.Cl.O=S(=O)(c1ccc(-c2ccccc2)cc1)n1ccc2cc(N3CCNCC3)ccc21 |
| InChI | InChI=1S/C24H23N3O2S.2ClH/c28-30(29,23-9-6-20(7-10-23)19-4-2-1-3-5-19)27-15-12-21-18-22(8-11-24(21)27)26-16-13-25-14-17-26;;/h1-12,15,18,25H,13-14,16-17H2;2*1H |
| InChIKey | SIBJAJKKKQZDQD-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.46 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |