C29H33N3O3S — CID 22015399
5-(4-benzylpiperazin-1-yl)-1-(4-butoxyphenyl)sulfonylindole (PubChem CID 22015399) has the molecular formula C29H33N3O3S and a molecular weight of 503.67 g/mol. Its IUPAC name is 5-(4-benzylpiperazin-1-yl)-1-(4-butoxyphenyl)sulfonylindole.
| Compound Name | 5-(4-benzylpiperazin-1-yl)-1-(4-butoxyphenyl)sulfonylindole |
|---|---|
| PubChem CID | 22015399 |
| Molecular Formula | C29H33N3O3S |
| Molecular Weight | 503.67 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | 5-(4-benzylpiperazin-1-yl)-1-(4-butoxyphenyl)sulfonylindole |
| SMILES | CCCCOc1ccc(S(=O)(=O)n2ccc3cc(N4CCN(Cc5ccccc5)CC4)ccc32)cc1 |
| InChI | InChI=1S/C29H33N3O3S/c1-2-3-21-35-27-10-12-28(13-11-27)36(33,34)32-16-15-25-22-26(9-14-29(25)32)31-19-17-30(18-20-31)23-24-7-5-4-6-8-24/h4-16,22H,2-3,17-21,23H2,1H3 |
| InChIKey | XSGMFWNSTRUFKG-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.67 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|