C31H30ClN3O2S — CID 69049725
5-(4-benzylpiperazin-1-yl)-1-(4-phenylphenyl)sulfonylindole;hydrochloride (PubChem CID 69049725) has the molecular formula C31H30ClN3O2S and a molecular weight of 544.12 g/mol. Its IUPAC name is 5-(4-benzylpiperazin-1-yl)-1-(4-phenylphenyl)sulfonylindole;hydrochloride.
| Compound Name | 5-(4-benzylpiperazin-1-yl)-1-(4-phenylphenyl)sulfonylindole;hydrochloride |
|---|---|
| PubChem CID | 69049725 |
| Molecular Formula | C31H30ClN3O2S |
| Molecular Weight | 544.12 g/mol |
| Exact Mass | 543.17 |
| IUPAC Name | 5-(4-benzylpiperazin-1-yl)-1-(4-phenylphenyl)sulfonylindole;hydrochloride |
| SMILES | Cl.O=S(=O)(c1ccc(-c2ccccc2)cc1)n1ccc2cc(N3CCN(Cc4ccccc4)CC3)ccc21 |
| InChI | InChI=1S/C31H29N3O2S.ClH/c35-37(36,30-14-11-27(12-15-30)26-9-5-2-6-10-26)34-18-17-28-23-29(13-16-31(28)34)33-21-19-32(20-22-33)24-25-7-3-1-4-8-25;/h1-18,23H,19-22,24H2;1H |
| InChIKey | VANJKZYFQBSECJ-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.12 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |