C21H21N5O4S — CID 158933529
formic acid;3-(6-piperazin-1-ylindazol-1-yl)sulfonylquinoline (PubChem CID 158933529) has the molecular formula C21H21N5O4S and a molecular weight of 439.50 g/mol. Its IUPAC name is formic acid;3-(6-piperazin-1-ylindazol-1-yl)sulfonylquinoline.
| Compound Name | formic acid;3-(6-piperazin-1-ylindazol-1-yl)sulfonylquinoline |
|---|---|
| PubChem CID | 158933529 |
| Molecular Formula | C21H21N5O4S |
| Molecular Weight | 439.50 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | formic acid;3-(6-piperazin-1-ylindazol-1-yl)sulfonylquinoline |
| SMILES | O=CO.O=S(=O)(c1cnc2ccccc2c1)n1ncc2ccc(N3CCNCC3)cc21 |
| InChI | InChI=1S/C20H19N5O2S.CH2O2/c26-28(27,18-11-15-3-1-2-4-19(15)22-14-18)25-20-12-17(6-5-16(20)13-23-25)24-9-7-21-8-10-24;2-1-3/h1-6,11-14,21H,7-10H2;1H,(H,2,3) |
| InChIKey | JJJCEOATDBBDDW-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 117.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.50 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|