C21H21N5O3S — CID 143765626
formaldehyde;3-(3-piperazin-1-ylpyrrolo[3,2-b]pyridin-1-yl)sulfonylquinoline (PubChem CID 143765626) has the molecular formula C21H21N5O3S and a molecular weight of 423.50 g/mol. Its IUPAC name is formaldehyde;3-(3-piperazin-1-ylpyrrolo[3,2-b]pyridin-1-yl)sulfonylquinoline.
| Compound Name | formaldehyde;3-(3-piperazin-1-ylpyrrolo[3,2-b]pyridin-1-yl)sulfonylquinoline |
|---|---|
| PubChem CID | 143765626 |
| Molecular Formula | C21H21N5O3S |
| Molecular Weight | 423.50 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | formaldehyde;3-(3-piperazin-1-ylpyrrolo[3,2-b]pyridin-1-yl)sulfonylquinoline |
| SMILES | C=O.O=S(=O)(c1cnc2ccccc2c1)n1cc(N2CCNCC2)c2ncccc21 |
| InChI | InChI=1S/C20H19N5O2S.CH2O/c26-28(27,16-12-15-4-1-2-5-17(15)23-13-16)25-14-19(24-10-8-21-9-11-24)20-18(25)6-3-7-22-20;1-2/h1-7,12-14,21H,8-11H2;1H2 |
| InChIKey | BATBCPUWRQBWFQ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.50 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |