C19H18ClN5O4S — CID 157205200
3-chloro-4-(3-piperazin-1-ylpyrrolo[3,2-b]pyridin-1-yl)sulfonylbenzonitrile;formic acid (PubChem CID 157205200) has the molecular formula C19H18ClN5O4S and a molecular weight of 447.90 g/mol. Its IUPAC name is 3-chloro-4-(3-piperazin-1-ylpyrrolo[3,2-b]pyridin-1-yl)sulfonylbenzonitrile;formic acid.
| Compound Name | 3-chloro-4-(3-piperazin-1-ylpyrrolo[3,2-b]pyridin-1-yl)sulfonylbenzonitrile;formic acid |
|---|---|
| PubChem CID | 157205200 |
| Molecular Formula | C19H18ClN5O4S |
| Molecular Weight | 447.90 g/mol |
| Exact Mass | 447.08 |
| IUPAC Name | 3-chloro-4-(3-piperazin-1-ylpyrrolo[3,2-b]pyridin-1-yl)sulfonylbenzonitrile;formic acid |
| SMILES | N#Cc1ccc(S(=O)(=O)n2cc(N3CCNCC3)c3ncccc32)c(Cl)c1.O=CO |
| InChI | InChI=1S/C18H16ClN5O2S.CH2O2/c19-14-10-13(11-20)3-4-17(14)27(25,26)24-12-16(23-8-6-21-7-9-23)18-15(24)2-1-5-22-18;2-1-3/h1-5,10,12,21H,6-9H2;1H,(H,2,3) |
| InChIKey | ARGRJOVVHUTQOR-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 128.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.90 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|