C20H19N3O4S — CID 91304164
3-(3-cyclopentylpyrrolo[3,2-b]pyridin-1-yl)sulfonylbenzonitrile;formic acid (PubChem CID 91304164) has the molecular formula C20H19N3O4S and a molecular weight of 397.46 g/mol. Its IUPAC name is 3-(3-cyclopentylpyrrolo[3,2-b]pyridin-1-yl)sulfonylbenzonitrile;formic acid.
| Compound Name | 3-(3-cyclopentylpyrrolo[3,2-b]pyridin-1-yl)sulfonylbenzonitrile;formic acid |
|---|---|
| PubChem CID | 91304164 |
| Molecular Formula | C20H19N3O4S |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | 3-(3-cyclopentylpyrrolo[3,2-b]pyridin-1-yl)sulfonylbenzonitrile;formic acid |
| SMILES | N#Cc1cccc(S(=O)(=O)n2cc(C3CCCC3)c3ncccc32)c1.O=CO |
| InChI | InChI=1S/C19H17N3O2S.CH2O2/c20-12-14-5-3-8-16(11-14)25(23,24)22-13-17(15-6-1-2-7-15)19-18(22)9-4-10-21-19;2-1-3/h3-5,8-11,13,15H,1-2,6-7H2;1H,(H,2,3) |
| InChIKey | VXNCIPLYIUMGHM-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 113.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|