C22H25ClN4O4S — CID 158289704
2-[1-(4-chlorophenyl)sulfonylpyrrolo[3,2-b]pyridin-3-yl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine;formic acid (PubChem CID 158289704) has the molecular formula C22H25ClN4O4S and a molecular weight of 476.99 g/mol. Its IUPAC name is 2-[1-(4-chlorophenyl)sulfonylpyrrolo[3,2-b]pyridin-3-yl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine;formic acid.
| Compound Name | 2-[1-(4-chlorophenyl)sulfonylpyrrolo[3,2-b]pyridin-3-yl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine;formic acid |
|---|---|
| PubChem CID | 158289704 |
| Molecular Formula | C22H25ClN4O4S |
| Molecular Weight | 476.99 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | 2-[1-(4-chlorophenyl)sulfonylpyrrolo[3,2-b]pyridin-3-yl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine;formic acid |
| SMILES | O=CO.O=S(=O)(c1ccc(Cl)cc1)n1cc(N2CCN3CCCCC3C2)c2ncccc21 |
| InChI | InChI=1S/C21H23ClN4O2S.CH2O2/c22-16-6-8-18(9-7-16)29(27,28)26-15-20(21-19(26)5-3-10-23-21)25-13-12-24-11-2-1-4-17(24)14-25;2-1-3/h3,5-10,15,17H,1-2,4,11-14H2;1H,(H,2,3) |
| InChIKey | GLFBOUJHTNDDLV-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.99 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|