C21H24F2N4O5S — CID 159220843
1-[3-(difluoromethoxy)phenyl]sulfonyl-3-[(3S)-3-ethylpiperazin-1-yl]pyrrolo[3,2-b]pyridine;formic acid (PubChem CID 159220843) has the molecular formula C21H24F2N4O5S and a molecular weight of 482.51 g/mol. Its IUPAC name is 1-[3-(difluoromethoxy)phenyl]sulfonyl-3-[(3S)-3-ethylpiperazin-1-yl]pyrrolo[3,2-b]pyridine;formic acid.
| Compound Name | 1-[3-(difluoromethoxy)phenyl]sulfonyl-3-[(3S)-3-ethylpiperazin-1-yl]pyrrolo[3,2-b]pyridine;formic acid |
|---|---|
| PubChem CID | 159220843 |
| Molecular Formula | C21H24F2N4O5S |
| Molecular Weight | 482.51 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | 1-[3-(difluoromethoxy)phenyl]sulfonyl-3-[(3S)-3-ethylpiperazin-1-yl]pyrrolo[3,2-b]pyridine;formic acid |
| SMILES | CC[C@H]1CN(c2cn(S(=O)(=O)c3cccc(OC(F)F)c3)c3cccnc23)CCN1.O=CO |
| InChI | InChI=1S/C20H22F2N4O3S.CH2O2/c1-2-14-12-25(10-9-23-14)18-13-26(17-7-4-8-24-19(17)18)30(27,28)16-6-3-5-15(11-16)29-20(21)22;2-1-3/h3-8,11,13-14,20,23H,2,9-10,12H2,1H3;1H,(H,2,3)/t14-;/m0./s1 |
| InChIKey | KRQVOESQNXCPFH-UQKRIMTDSA-N |
| XLogP | 2.76 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.51 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|