C19H21FN4O4S — CID 159543886
1-(2-fluorophenyl)sulfonyl-3-[(3S)-3-methylpiperazin-1-yl]pyrrolo[3,2-b]pyridine;formic acid (PubChem CID 159543886) has the molecular formula C19H21FN4O4S and a molecular weight of 420.47 g/mol. Its IUPAC name is 1-(2-fluorophenyl)sulfonyl-3-[(3S)-3-methylpiperazin-1-yl]pyrrolo[3,2-b]pyridine;formic acid.
| Compound Name | 1-(2-fluorophenyl)sulfonyl-3-[(3S)-3-methylpiperazin-1-yl]pyrrolo[3,2-b]pyridine;formic acid |
|---|---|
| PubChem CID | 159543886 |
| Molecular Formula | C19H21FN4O4S |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 1-(2-fluorophenyl)sulfonyl-3-[(3S)-3-methylpiperazin-1-yl]pyrrolo[3,2-b]pyridine;formic acid |
| SMILES | C[C@H]1CN(c2cn(S(=O)(=O)c3ccccc3F)c3cccnc23)CCN1.O=CO |
| InChI | InChI=1S/C18H19FN4O2S.CH2O2/c1-13-11-22(10-9-20-13)16-12-23(15-6-4-8-21-18(15)16)26(24,25)17-7-3-2-5-14(17)19;2-1-3/h2-8,12-13,20H,9-11H2,1H3;1H,(H,2,3)/t13-;/m0./s1 |
| InChIKey | MENYHVMMJFIERR-ZOWNYOTGSA-N |
| XLogP | 1.91 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|