C19H21FN4O4S — CID 160950406
1-(2-fluoro-5-methylphenyl)sulfonyl-3-piperazin-1-ylpyrrolo[3,2-b]pyridine;formic acid (PubChem CID 160950406) has the molecular formula C19H21FN4O4S and a molecular weight of 420.47 g/mol. Its IUPAC name is 1-(2-fluoro-5-methylphenyl)sulfonyl-3-piperazin-1-ylpyrrolo[3,2-b]pyridine;formic acid.
| Compound Name | 1-(2-fluoro-5-methylphenyl)sulfonyl-3-piperazin-1-ylpyrrolo[3,2-b]pyridine;formic acid |
|---|---|
| PubChem CID | 160950406 |
| Molecular Formula | C19H21FN4O4S |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 1-(2-fluoro-5-methylphenyl)sulfonyl-3-piperazin-1-ylpyrrolo[3,2-b]pyridine;formic acid |
| SMILES | Cc1ccc(F)c(S(=O)(=O)n2cc(N3CCNCC3)c3ncccc32)c1.O=CO |
| InChI | InChI=1S/C18H19FN4O2S.CH2O2/c1-13-4-5-14(19)17(11-13)26(24,25)23-12-16(22-9-7-20-8-10-22)18-15(23)3-2-6-21-18;2-1-3/h2-6,11-12,20H,7-10H2,1H3;1H,(H,2,3) |
| InChIKey | SVRIPJWCRPOVHU-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|