C20H23N3O4S — CID 157153001
1-(benzenesulfonyl)-3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]pyrrolo[3,2-b]pyridine;formic acid (PubChem CID 157153001) has the molecular formula C20H23N3O4S and a molecular weight of 401.49 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]pyrrolo[3,2-b]pyridine;formic acid.
| Compound Name | 1-(benzenesulfonyl)-3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]pyrrolo[3,2-b]pyridine;formic acid |
|---|---|
| PubChem CID | 157153001 |
| Molecular Formula | C20H23N3O4S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 1-(benzenesulfonyl)-3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]pyrrolo[3,2-b]pyridine;formic acid |
| SMILES | CN1CCC[C@@H]1Cc1cn(S(=O)(=O)c2ccccc2)c2cccnc12.O=CO |
| InChI | InChI=1S/C19H21N3O2S.CH2O2/c1-21-12-6-7-16(21)13-15-14-22(18-10-5-11-20-19(15)18)25(23,24)17-8-3-2-4-9-17;2-1-3/h2-5,8-11,14,16H,6-7,12-13H2,1H3;1H,(H,2,3)/t16-;/m1./s1 |
| InChIKey | ALLXTMZVMDDVMJ-PKLMIRHRSA-N |
| XLogP | 2.61 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|