C20H22N2O3S — CID 54049957
1-(benzenesulfonyl)-3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]indol-2-ol (PubChem CID 54049957) has the molecular formula C20H22N2O3S and a molecular weight of 370.47 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]indol-2-ol.
| Compound Name | 1-(benzenesulfonyl)-3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]indol-2-ol |
|---|---|
| PubChem CID | 54049957 |
| Molecular Formula | C20H22N2O3S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 1-(benzenesulfonyl)-3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]indol-2-ol |
| SMILES | CN1CCC[C@@H]1Cc1c(O)n(S(=O)(=O)c2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C20H22N2O3S/c1-21-13-7-8-15(21)14-18-17-11-5-6-12-19(17)22(20(18)23)26(24,25)16-9-3-2-4-10-16/h2-6,9-12,15,23H,7-8,13-14H2,1H3/t15-/m1/s1 |
| InChIKey | LSEHPWVMCCPAKN-OAHLLOKOSA-N |
| XLogP | 3.22 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |