C19H24N4 — CID 143921679
aniline;3-[(1-methylpyrrolidin-2-yl)methyl]-1H-pyrrolo[3,2-b]pyridine (PubChem CID 143921679) has the molecular formula C19H24N4 and a molecular weight of 308.43 g/mol. Its IUPAC name is aniline;3-[(1-methylpyrrolidin-2-yl)methyl]-1H-pyrrolo[3,2-b]pyridine.
| Compound Name | aniline;3-[(1-methylpyrrolidin-2-yl)methyl]-1H-pyrrolo[3,2-b]pyridine |
|---|---|
| PubChem CID | 143921679 |
| Molecular Formula | C19H24N4 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | aniline;3-[(1-methylpyrrolidin-2-yl)methyl]-1H-pyrrolo[3,2-b]pyridine |
| SMILES | CN1CCCC1Cc1c[nH]c2cccnc12.Nc1ccccc1 |
| InChI | InChI=1S/C13H17N3.C6H7N/c1-16-7-3-4-11(16)8-10-9-15-12-5-2-6-14-13(10)12;7-6-4-2-1-3-5-6/h2,5-6,9,11,15H,3-4,7-8H2,1H3;1-5H,7H2 |
| InChIKey | UMTMKRNRXLUHGL-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|