C19H22N4S — CID 58483573
6-(1,4-diazepan-1-yl)-3-methylsulfanyl-1-phenylindazole (PubChem CID 58483573) has the molecular formula C19H22N4S and a molecular weight of 338.48 g/mol. Its IUPAC name is 6-(1,4-diazepan-1-yl)-3-methylsulfanyl-1-phenylindazole.
| Compound Name | 6-(1,4-diazepan-1-yl)-3-methylsulfanyl-1-phenylindazole |
|---|---|
| PubChem CID | 58483573 |
| Molecular Formula | C19H22N4S |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 6-(1,4-diazepan-1-yl)-3-methylsulfanyl-1-phenylindazole |
| SMILES | CSc1nn(-c2ccccc2)c2cc(N3CCCNCC3)ccc12 |
| InChI | InChI=1S/C19H22N4S/c1-24-19-17-9-8-16(22-12-5-10-20-11-13-22)14-18(17)23(21-19)15-6-3-2-4-7-15/h2-4,6-9,14,20H,5,10-13H2,1H3 |
| InChIKey | LLFAXCTYEOFGQG-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |