C23H22N6OS — CID 118662756
[3-methylsulfanyl-1-(5-phenylpyrimidin-2-yl)indazol-6-yl]-piperazin-1-ylmethanone (PubChem CID 118662756) has the molecular formula C23H22N6OS and a molecular weight of 430.54 g/mol. Its IUPAC name is [3-methylsulfanyl-1-(5-phenylpyrimidin-2-yl)indazol-6-yl]-piperazin-1-ylmethanone.
| Compound Name | [3-methylsulfanyl-1-(5-phenylpyrimidin-2-yl)indazol-6-yl]-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 118662756 |
| Molecular Formula | C23H22N6OS |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | [3-methylsulfanyl-1-(5-phenylpyrimidin-2-yl)indazol-6-yl]-piperazin-1-ylmethanone |
| SMILES | CSc1nn(-c2ncc(-c3ccccc3)cn2)c2cc(C(=O)N3CCNCC3)ccc12 |
| InChI | InChI=1S/C23H22N6OS/c1-31-21-19-8-7-17(22(30)28-11-9-24-10-12-28)13-20(19)29(27-21)23-25-14-18(15-26-23)16-5-3-2-4-6-16/h2-8,13-15,24H,9-12H2,1H3 |
| InChIKey | DREQBMAOLJQFMB-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |