C25H23N5O2 — CID 137367126
[1-cyclopropyl-3-(5-phenylpyrimidin-2-yl)indazol-5-yl]-morpholin-4-ylmethanone (PubChem CID 137367126) has the molecular formula C25H23N5O2 and a molecular weight of 425.49 g/mol. Its IUPAC name is [1-cyclopropyl-3-(5-phenylpyrimidin-2-yl)indazol-5-yl]-morpholin-4-ylmethanone.
| Compound Name | [1-cyclopropyl-3-(5-phenylpyrimidin-2-yl)indazol-5-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 137367126 |
| Molecular Formula | C25H23N5O2 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | [1-cyclopropyl-3-(5-phenylpyrimidin-2-yl)indazol-5-yl]-morpholin-4-ylmethanone |
| SMILES | O=C(c1ccc2c(c1)c(-c1ncc(-c3ccccc3)cn1)nn2C1CC1)N1CCOCC1 |
| InChI | InChI=1S/C25H23N5O2/c31-25(29-10-12-32-13-11-29)18-6-9-22-21(14-18)23(28-30(22)20-7-8-20)24-26-15-19(16-27-24)17-4-2-1-3-5-17/h1-6,9,14-16,20H,7-8,10-13H2 |
| InChIKey | CBTWGSSWZCUYGF-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |