About 1-methylpiperidine;3-phenylpiperidine;pyridine
1-methylpiperidine;3-phenylpiperidine;pyridine (PubChem CID 70537443) has the molecular formula C22H33N3
and a molecular weight of 339.53 g/mol. Its IUPAC name is 1-methylpiperidine;3-phenylpiperidine;pyridine.
Molecular Properties
| Compound Name | 1-methylpiperidine;3-phenylpiperidine;pyridine |
| PubChem CID | 70537443 |
| Molecular Formula | C22H33N3 |
| Molecular Weight | 339.53 g/mol |
| Exact Mass | 339.27 |
| IUPAC Name | 1-methylpiperidine;3-phenylpiperidine;pyridine |
| SMILES | CN1CCCCC1.c1ccc(C2CCCNC2)cc1.c1ccncc1 |
| InChI | InChI=1S/C11H15N.C6H13N.C5H5N/c1-2-5-10(6-3-1)11-7-4-8-12-9-11;1-7-5-3-2-4-6-7;1-2-4-6-5-3-1/h1-3,5-6,11-12H,4,7-9H2;2-6H2,1H3;1-5H |
| InChIKey | RKMNVDSRSUXXBZ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.53 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methylpiperidine;3-phenylpiperidine;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylpiperidine;3-phenylpiperidine;pyridine?
The IUPAC name of 1-methylpiperidine;3-phenylpiperidine;pyridine (CID 70537443) is 1-methylpiperidine;3-phenylpiperidine;pyridine.
What is the SMILES notation for 1-methylpiperidine;3-phenylpiperidine;pyridine?
The canonical SMILES for 1-methylpiperidine;3-phenylpiperidine;pyridine is CN1CCCCC1.c1ccc(C2CCCNC2)cc1.c1ccncc1.
What is the InChIKey of 1-methylpiperidine;3-phenylpiperidine;pyridine?
The InChIKey is RKMNVDSRSUXXBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N.C6H13N.C5H5N/c1-2-5-10(6-3-1)11-7-4-8-12-9-11;1-7-5-3-2-4-6-7;1-2-4-6-5-3-1/h1-3,5-6,11-12H,4,7-9H2;2-6H2,1H3;1-5H.
What are the key properties of 1-methylpiperidine;3-phenylpiperidine;pyridine?
1-methylpiperidine;3-phenylpiperidine;pyridine has a molecular weight of 339.53 g/mol, XLogP of 4.34, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylpiperidine;3-phenylpiperidine;pyridine is sourced from PubChem (CID 70537443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).