About CID 156632351
CID 156632351 (PubChem CID 156632351) has the molecular formula C9H12ClFN2
and a molecular weight of 202.66 g/mol.
Molecular Properties
| Compound Name | CID 156632351 |
| PubChem CID | 156632351 |
| Molecular Formula | C9H12ClFN2 |
| Molecular Weight | 202.66 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | — |
| SMILES | FCl.c1cc(C2CCNC2)ccn1 |
| InChI | InChI=1S/C9H12N2.ClF/c1-4-10-5-2-8(1)9-3-6-11-7-9;1-2/h1-2,4-5,9,11H,3,6-7H2; |
| InChIKey | OWJMETHKCUMPAC-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.66 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 156632351 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 156632351?
The IUPAC name of CID 156632351 (CID 156632351) is not available.
What is the SMILES notation for CID 156632351?
The canonical SMILES for CID 156632351 is FCl.c1cc(C2CCNC2)ccn1.
What is the InChIKey of CID 156632351?
The InChIKey is OWJMETHKCUMPAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2.ClF/c1-4-10-5-2-8(1)9-3-6-11-7-9;1-2/h1-2,4-5,9,11H,3,6-7H2;.
What are the key properties of CID 156632351?
CID 156632351 has a molecular weight of 202.66 g/mol, XLogP of 2.27, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 156632351 is sourced from PubChem (CID 156632351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).