C7H10N2O — CID 53429261
5-pyrrolidin-3-yl-1,2-oxazole (PubChem CID 53429261) has the molecular formula C7H10N2O and a molecular weight of 138.17 g/mol. Its IUPAC name is 5-pyrrolidin-3-yl-1,2-oxazole.
| Compound Name | 5-pyrrolidin-3-yl-1,2-oxazole |
|---|---|
| PubChem CID | 53429261 |
| Molecular Formula | C7H10N2O |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | 5-pyrrolidin-3-yl-1,2-oxazole |
| SMILES | c1cc(C2CCNC2)on1 |
| InChI | InChI=1S/C7H10N2O/c1-3-8-5-6(1)7-2-4-9-10-7/h2,4,6,8H,1,3,5H2 |
| InChIKey | ZQCMJHCSXCMVNR-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |