C31H44O4 — CID 150310481
2,2-bis[4-(2,4,4-trimethylpentan-2-yl)phenyl]propanedioic acid (PubChem CID 150310481) has the molecular formula C31H44O4 and a molecular weight of 480.69 g/mol. Its IUPAC name is 2,2-bis[4-(2,4,4-trimethylpentan-2-yl)phenyl]propanedioic acid.
| Compound Name | 2,2-bis[4-(2,4,4-trimethylpentan-2-yl)phenyl]propanedioic acid |
|---|---|
| PubChem CID | 150310481 |
| Molecular Formula | C31H44O4 |
| Molecular Weight | 480.69 g/mol |
| Exact Mass | 480.32 |
| IUPAC Name | 2,2-bis[4-(2,4,4-trimethylpentan-2-yl)phenyl]propanedioic acid |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(C(C(=O)O)(C(=O)O)c2ccc(C(C)(C)CC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C31H44O4/c1-27(2,3)19-29(7,8)21-11-15-23(16-12-21)31(25(32)33,26(34)35)24-17-13-22(14-18-24)30(9,10)20-28(4,5)6/h11-18H,19-20H2,1-10H3,(H,32,33)(H,34,35) |
| InChIKey | GLMUKCHDMSTZCA-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.69 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|