C14H20O2S — CID 177150300
2,2,4-trimethyl-4-(4-sulfanylphenyl)pentanoic acid (PubChem CID 177150300) has the molecular formula C14H20O2S and a molecular weight of 252.38 g/mol. Its IUPAC name is 2,2,4-trimethyl-4-(4-sulfanylphenyl)pentanoic acid.
| Compound Name | 2,2,4-trimethyl-4-(4-sulfanylphenyl)pentanoic acid |
|---|---|
| PubChem CID | 177150300 |
| Molecular Formula | C14H20O2S |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 2,2,4-trimethyl-4-(4-sulfanylphenyl)pentanoic acid |
| SMILES | CC(C)(CC(C)(C)c1ccc(S)cc1)C(=O)O |
| InChI | InChI=1S/C14H20O2S/c1-13(2,9-14(3,4)12(15)16)10-5-7-11(17)8-6-10/h5-8,17H,9H2,1-4H3,(H,15,16) |
| InChIKey | VBVAVFHCXDBQLR-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|