C16H28N2 — CID 80556642
4-[1-[2,2-dimethylpropyl(methyl)amino]-2-methylpropan-2-yl]aniline (PubChem CID 80556642) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is 4-[1-[2,2-dimethylpropyl(methyl)amino]-2-methylpropan-2-yl]aniline.
| Compound Name | 4-[1-[2,2-dimethylpropyl(methyl)amino]-2-methylpropan-2-yl]aniline |
|---|---|
| PubChem CID | 80556642 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | 4-[1-[2,2-dimethylpropyl(methyl)amino]-2-methylpropan-2-yl]aniline |
| SMILES | CN(CC(C)(C)C)CC(C)(C)c1ccc(N)cc1 |
| InChI | InChI=1S/C16H28N2/c1-15(2,3)11-18(6)12-16(4,5)13-7-9-14(17)10-8-13/h7-10H,11-12,17H2,1-6H3 |
| InChIKey | RETKTTLJHFNWPD-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|