C16H21BrN2S — CID 80556115
4-[1-[(4-bromothiophen-2-yl)methyl-methylamino]-2-methylpropan-2-yl]aniline (PubChem CID 80556115) has the molecular formula C16H21BrN2S and a molecular weight of 353.33 g/mol. Its IUPAC name is 4-[1-[(4-bromothiophen-2-yl)methyl-methylamino]-2-methylpropan-2-yl]aniline.
| Compound Name | 4-[1-[(4-bromothiophen-2-yl)methyl-methylamino]-2-methylpropan-2-yl]aniline |
|---|---|
| PubChem CID | 80556115 |
| Molecular Formula | C16H21BrN2S |
| Molecular Weight | 353.33 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 4-[1-[(4-bromothiophen-2-yl)methyl-methylamino]-2-methylpropan-2-yl]aniline |
| SMILES | CN(Cc1cc(Br)cs1)CC(C)(C)c1ccc(N)cc1 |
| InChI | InChI=1S/C16H21BrN2S/c1-16(2,12-4-6-14(18)7-5-12)11-19(3)9-15-8-13(17)10-20-15/h4-8,10H,9,11,18H2,1-3H3 |
| InChIKey | XGUMXUPNXNQHSK-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.33 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|