C13H14Br2N2S — CID 114048491
2-bromo-3-[[(4-bromothiophen-2-yl)methyl-methylamino]methyl]aniline (PubChem CID 114048491) has the molecular formula C13H14Br2N2S and a molecular weight of 390.14 g/mol. Its IUPAC name is 2-bromo-3-[[(4-bromothiophen-2-yl)methyl-methylamino]methyl]aniline.
| Compound Name | 2-bromo-3-[[(4-bromothiophen-2-yl)methyl-methylamino]methyl]aniline |
|---|---|
| PubChem CID | 114048491 |
| Molecular Formula | C13H14Br2N2S |
| Molecular Weight | 390.14 g/mol |
| Exact Mass | 387.92 |
| IUPAC Name | 2-bromo-3-[[(4-bromothiophen-2-yl)methyl-methylamino]methyl]aniline |
| SMILES | CN(Cc1cc(Br)cs1)Cc1cccc(N)c1Br |
| InChI | InChI=1S/C13H14Br2N2S/c1-17(7-11-5-10(14)8-18-11)6-9-3-2-4-12(16)13(9)15/h2-5,8H,6-7,16H2,1H3 |
| InChIKey | LBJRTNSCUFWZAP-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.14 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|