C15H18BrN3OS — CID 105351841
2-[4-[[(4-bromothiophen-2-yl)methyl-methylamino]methyl]phenyl]acetohydrazide (PubChem CID 105351841) has the molecular formula C15H18BrN3OS and a molecular weight of 368.30 g/mol. Its IUPAC name is 2-[4-[[(4-bromothiophen-2-yl)methyl-methylamino]methyl]phenyl]acetohydrazide.
| Compound Name | 2-[4-[[(4-bromothiophen-2-yl)methyl-methylamino]methyl]phenyl]acetohydrazide |
|---|---|
| PubChem CID | 105351841 |
| Molecular Formula | C15H18BrN3OS |
| Molecular Weight | 368.30 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | 2-[4-[[(4-bromothiophen-2-yl)methyl-methylamino]methyl]phenyl]acetohydrazide |
| SMILES | CN(Cc1ccc(CC(=O)NN)cc1)Cc1cc(Br)cs1 |
| InChI | InChI=1S/C15H18BrN3OS/c1-19(9-14-7-13(16)10-21-14)8-12-4-2-11(3-5-12)6-15(20)18-17/h2-5,7,10H,6,8-9,17H2,1H3,(H,18,20) |
| InChIKey | AOEXGMUYRPFNHS-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.30 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|