C10H13Br2NOS — CID 114328199
2-bromo-N-[(4-bromothiophen-2-yl)methyl]-N,2-dimethylpropanamide (PubChem CID 114328199) has the molecular formula C10H13Br2NOS and a molecular weight of 355.10 g/mol. Its IUPAC name is 2-bromo-N-[(4-bromothiophen-2-yl)methyl]-N,2-dimethylpropanamide.
| Compound Name | 2-bromo-N-[(4-bromothiophen-2-yl)methyl]-N,2-dimethylpropanamide |
|---|---|
| PubChem CID | 114328199 |
| Molecular Formula | C10H13Br2NOS |
| Molecular Weight | 355.10 g/mol |
| Exact Mass | 352.91 |
| IUPAC Name | 2-bromo-N-[(4-bromothiophen-2-yl)methyl]-N,2-dimethylpropanamide |
| SMILES | CN(Cc1cc(Br)cs1)C(=O)C(C)(C)Br |
| InChI | InChI=1S/C10H13Br2NOS/c1-10(2,12)9(14)13(3)5-8-4-7(11)6-15-8/h4,6H,5H2,1-3H3 |
| InChIKey | VKDVSSFDDHFOCY-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.10 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|