C10H14BrNOS2 — CID 55028858
N-[(4-bromothiophen-2-yl)methyl]-N-methyl-3-methylsulfanylpropanamide (PubChem CID 55028858) has the molecular formula C10H14BrNOS2 and a molecular weight of 308.27 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-N-methyl-3-methylsulfanylpropanamide.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-N-methyl-3-methylsulfanylpropanamide |
|---|---|
| PubChem CID | 55028858 |
| Molecular Formula | C10H14BrNOS2 |
| Molecular Weight | 308.27 g/mol |
| Exact Mass | 306.97 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-N-methyl-3-methylsulfanylpropanamide |
| SMILES | CSCCC(=O)N(C)Cc1cc(Br)cs1 |
| InChI | InChI=1S/C10H14BrNOS2/c1-12(10(13)3-4-14-2)6-9-5-8(11)7-15-9/h5,7H,3-4,6H2,1-2H3 |
| InChIKey | GDBDNQDSQZNTHU-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.27 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |