C12H15BrN2O2S2 — CID 55743062
N-[(4-bromothiophen-2-yl)methyl]-N-methyl-3-(2-oxo-1,3-thiazolidin-3-yl)propanamide (PubChem CID 55743062) has the molecular formula C12H15BrN2O2S2 and a molecular weight of 363.30 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-N-methyl-3-(2-oxo-1,3-thiazolidin-3-yl)propanamide.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-N-methyl-3-(2-oxo-1,3-thiazolidin-3-yl)propanamide |
|---|---|
| PubChem CID | 55743062 |
| Molecular Formula | C12H15BrN2O2S2 |
| Molecular Weight | 363.30 g/mol |
| Exact Mass | 361.98 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-N-methyl-3-(2-oxo-1,3-thiazolidin-3-yl)propanamide |
| SMILES | CN(Cc1cc(Br)cs1)C(=O)CCN1CCSC1=O |
| InChI | InChI=1S/C12H15BrN2O2S2/c1-14(7-10-6-9(13)8-19-10)11(16)2-3-15-4-5-18-12(15)17/h6,8H,2-5,7H2,1H3 |
| InChIKey | AFEDPTWELIXRDW-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.30 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|