C16H18Cl2N2O4S — CID 55442791
[2-[(3,4-dichlorophenyl)methyl-methylamino]-2-oxoethyl] 3-(2-oxo-1,3-thiazolidin-3-yl)propanoate (PubChem CID 55442791) has the molecular formula C16H18Cl2N2O4S and a molecular weight of 405.30 g/mol. Its IUPAC name is [2-[(3,4-dichlorophenyl)methyl-methylamino]-2-oxoethyl] 3-(2-oxo-1,3-thiazolidin-3-yl)propanoate.
| Compound Name | [2-[(3,4-dichlorophenyl)methyl-methylamino]-2-oxoethyl] 3-(2-oxo-1,3-thiazolidin-3-yl)propanoate |
|---|---|
| PubChem CID | 55442791 |
| Molecular Formula | C16H18Cl2N2O4S |
| Molecular Weight | 405.30 g/mol |
| Exact Mass | 404.04 |
| IUPAC Name | [2-[(3,4-dichlorophenyl)methyl-methylamino]-2-oxoethyl] 3-(2-oxo-1,3-thiazolidin-3-yl)propanoate |
| SMILES | CN(Cc1ccc(Cl)c(Cl)c1)C(=O)COC(=O)CCN1CCSC1=O |
| InChI | InChI=1S/C16H18Cl2N2O4S/c1-19(9-11-2-3-12(17)13(18)8-11)14(21)10-24-15(22)4-5-20-6-7-25-16(20)23/h2-3,8H,4-7,9-10H2,1H3 |
| InChIKey | RTMVOXFGIMCUFR-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.30 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|