C12H17BrN2O3S — CID 119912395
3-[[2-[(4-bromothiophen-2-yl)methyl-methylamino]-2-oxoethyl]-methylamino]propanoic acid (PubChem CID 119912395) has the molecular formula C12H17BrN2O3S and a molecular weight of 349.25 g/mol. Its IUPAC name is 3-[[2-[(4-bromothiophen-2-yl)methyl-methylamino]-2-oxoethyl]-methylamino]propanoic acid.
| Compound Name | 3-[[2-[(4-bromothiophen-2-yl)methyl-methylamino]-2-oxoethyl]-methylamino]propanoic acid |
|---|---|
| PubChem CID | 119912395 |
| Molecular Formula | C12H17BrN2O3S |
| Molecular Weight | 349.25 g/mol |
| Exact Mass | 348.01 |
| IUPAC Name | 3-[[2-[(4-bromothiophen-2-yl)methyl-methylamino]-2-oxoethyl]-methylamino]propanoic acid |
| SMILES | CN(CCC(=O)O)CC(=O)N(C)Cc1cc(Br)cs1 |
| InChI | InChI=1S/C12H17BrN2O3S/c1-14(4-3-12(17)18)7-11(16)15(2)6-10-5-9(13)8-19-10/h5,8H,3-4,6-7H2,1-2H3,(H,17,18) |
| InChIKey | ZPCVFEVYYPHRGC-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.25 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |