C7H10BrN3OS — CID 76944247
1-[(4-bromothiophen-2-yl)methyl]-2-hydroxy-1-methylguanidine (PubChem CID 76944247) has the molecular formula C7H10BrN3OS and a molecular weight of 264.15 g/mol. Its IUPAC name is 1-[(4-bromothiophen-2-yl)methyl]-2-hydroxy-1-methylguanidine.
| Compound Name | 1-[(4-bromothiophen-2-yl)methyl]-2-hydroxy-1-methylguanidine |
|---|---|
| PubChem CID | 76944247 |
| Molecular Formula | C7H10BrN3OS |
| Molecular Weight | 264.15 g/mol |
| Exact Mass | 262.97 |
| IUPAC Name | 1-[(4-bromothiophen-2-yl)methyl]-2-hydroxy-1-methylguanidine |
| SMILES | CN(Cc1cc(Br)cs1)C(N)=NO |
| InChI | InChI=1S/C7H10BrN3OS/c1-11(7(9)10-12)3-6-2-5(8)4-13-6/h2,4,12H,3H2,1H3,(H2,9,10) |
| InChIKey | YWFYXJDHROJVLG-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.15 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|