C13H15BrN2O2S2 — CID 62022448
1-(2-aminophenyl)-N-[(4-bromothiophen-2-yl)methyl]-N-methylmethanesulfonamide (PubChem CID 62022448) has the molecular formula C13H15BrN2O2S2 and a molecular weight of 375.31 g/mol. Its IUPAC name is 1-(2-aminophenyl)-N-[(4-bromothiophen-2-yl)methyl]-N-methylmethanesulfonamide.
| Compound Name | 1-(2-aminophenyl)-N-[(4-bromothiophen-2-yl)methyl]-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 62022448 |
| Molecular Formula | C13H15BrN2O2S2 |
| Molecular Weight | 375.31 g/mol |
| Exact Mass | 373.98 |
| IUPAC Name | 1-(2-aminophenyl)-N-[(4-bromothiophen-2-yl)methyl]-N-methylmethanesulfonamide |
| SMILES | CN(Cc1cc(Br)cs1)S(=O)(=O)Cc1ccccc1N |
| InChI | InChI=1S/C13H15BrN2O2S2/c1-16(7-12-6-11(14)8-19-12)20(17,18)9-10-4-2-3-5-13(10)15/h2-6,8H,7,9,15H2,1H3 |
| InChIKey | CTFXFUSXGOEQPR-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.31 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|