C10H17BrN2O2S2 — CID 54978733
N-[(4-bromothiophen-2-yl)methyl-methylsulfamoyl]-N-methylpropan-2-amine (PubChem CID 54978733) has the molecular formula C10H17BrN2O2S2 and a molecular weight of 341.30 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl-methylsulfamoyl]-N-methylpropan-2-amine.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl-methylsulfamoyl]-N-methylpropan-2-amine |
|---|---|
| PubChem CID | 54978733 |
| Molecular Formula | C10H17BrN2O2S2 |
| Molecular Weight | 341.30 g/mol |
| Exact Mass | 339.99 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl-methylsulfamoyl]-N-methylpropan-2-amine |
| SMILES | CC(C)N(C)S(=O)(=O)N(C)Cc1cc(Br)cs1 |
| InChI | InChI=1S/C10H17BrN2O2S2/c1-8(2)13(4)17(14,15)12(3)6-10-5-9(11)7-16-10/h5,7-8H,6H2,1-4H3 |
| InChIKey | BVARGJBBNLQDGV-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.30 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |